|
CAS#: 23957-72-4 Product: 2-(Mesitylamino)-1,1,2-Ethenetricarbonitrile No suppilers available for the product. |
| Name | 2-(Mesitylamino)-1,1,2-Ethenetricarbonitrile |
|---|---|
| Synonyms | 2-(Mesitylamino)-1,1,2-ethylenetricarbonitrile #; Ethenetricarbonitrile, (2,4,6-trimethylanilino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 23957-72-4 |
| SMILES | N#C/C(C#N)=C(\C#N)Nc1c(cc(cc1C)C)C |
| InChI | 1S/C14H12N4/c1-9-4-10(2)14(11(3)5-9)18-13(8-17)12(6-15)7-16/h4-5,18H,1-3H3 |
| InChIKey | WKZSXUIEPPHMAQ-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.236°C at 760 mmHg (Cal.) |
| Flash point | 166.222°C (Cal.) |
| Refractive index | 1.61 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Mesitylamino)-1,1,2-Ethenetricarbonitrile |