|
CAS#: 23966-62-3 Product: 3,4-Dihydro-3,3-Diphenyl-1(2H)-Isoquinolinone No suppilers available for the product. |
| Name | 3,4-Dihydro-3,3-Diphenyl-1(2H)-Isoquinolinone |
|---|---|
| Synonyms | Nsc123355; 3,3-Diphenyl-3,4-Dihydro-1-Isoquinolinol; Isocarbostyril, 3,4-Dihydro-3,3-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 |
| CAS Registry Number | 23966-62-3 |
| SMILES | C1=CC4=C(C=C1)CC(C2=CC=CC=C2)(C3=CC=CC=C3)NC4=O |
| InChI | 1S/C21H17NO/c23-20-19-14-8-7-9-16(19)15-21(22-20,17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14H,15H2,(H,22,23) |
| InChIKey | BNVIXDIOOBLBCE-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.723°C at 760 mmHg (Cal.) |
| Flash point | 302.841°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-3,3-Diphenyl-1(2H)-Isoquinolinone |