|
CAS#: 2398-95-0 Product: 2-[(1,2-Dihydroxy-1-Oxopropan-2-Yl)-Hydroxyphosphoryl]-2-Hydroxypropanoic Acid No suppilers available for the product. |
| Name | 2-[(1,2-Dihydroxy-1-Oxopropan-2-Yl)-Hydroxyphosphoryl]-2-Hydroxypropanoic Acid |
|---|---|
| Synonyms | 2-[(1,2-Dihydroxy-1-Methyl-2-Oxo-Ethyl)-Hydroxy-Phosphoryl]-2-Hydroxy-Propanoic Acid; 2-[(1,2-Dihydroxy-1-Methyl-2-Oxoethyl)-Hydroxyphosphoryl]-2-Hydroxypropanoic Acid; 2-[(1,2-Dihydroxy-2-Keto-1-Methyl-Ethyl)-Hydroxy-Phosphoryl]-2-Hydroxy-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11O8P |
| Molecular Weight | 242.12 |
| CAS Registry Number | 2398-95-0 |
| SMILES | CC([P](C(C(O)=O)(C)O)(O)=O)(C(O)=O)O |
| InChI | 1S/C6H11O8P/c1-5(11,3(7)8)15(13,14)6(2,12)4(9)10/h11-12H,1-2H3,(H,7,8)(H,9,10)(H,13,14) |
| InChIKey | RBMHUYBJIYNRLY-UHFFFAOYSA-N |
| Density | 1.812g/cm3 (Cal.) |
|---|---|
| Boiling point | 693.995°C at 760 mmHg (Cal.) |
| Flash point | 373.515°C (Cal.) |
| (1) | Jung Kwon Oh. Polylactide (PLA)-based amphiphilic block copolymers: synthesis, self-assembly, and biomedical applications, Soft Matter, 2011, 7, 5096. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[(1,2-Dihydroxy-1-Oxopropan-2-Yl)-Hydroxyphosphoryl]-2-Hydroxypropanoic Acid |