|
CAS#: 24073-66-3 Product: Methylenediarsonic Acid No suppilers available for the product. |
| Name | Methylenediarsonic Acid |
|---|---|
| Synonyms | Arsonic Acid, Methylenebis-; Methylenediarsonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | CH6As2O6 |
| Molecular Weight | 263.90 |
| CAS Registry Number | 24073-66-3 |
| SMILES | C([As](=O)(O)O)[As](=O)(O)O |
| InChI | 1S/CH6As2O6/c4-2(5,6)1-3(7,8)9/h1H2,(H2,4,5,6)(H2,7,8,9) |
| InChIKey | GLAQLYJZMPCOFF-UHFFFAOYSA-N |
| Boiling point | 832.75°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 471.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylenediarsonic Acid |