| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 3-(4-Chlorophenyl)-5-(4-Methoxyphenyl)Isoxazole |
|---|---|
| Synonyms | 3-(4-Chlorophenyl)-5-(4-Methoxyphenyl)Isoxazole; Nsc129400 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.73 |
| CAS Registry Number | 24097-19-6 |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)C3=CC=C(OC)C=C3)Cl |
| InChI | 1S/C16H12ClNO2/c1-19-14-8-4-12(5-9-14)16-10-15(18-20-16)11-2-6-13(17)7-3-11/h2-10H,1H3 |
| InChIKey | RKJMFQXQWFNZIF-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.014°C at 760 mmHg (Cal.) |
| Flash point | 227.775°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chlorophenyl)-5-(4-Methoxyphenyl)Isoxazole |