|
CAS#: 24169-32-2 Product: 2-(Bromomethyl)-2-(2,3,4-Trichlorophenyl)-1,3-Dioxolane No suppilers available for the product. |
| Name | 2-(Bromomethyl)-2-(2,3,4-Trichlorophenyl)-1,3-Dioxolane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H8BrCl3O2 |
| Molecular Weight | 346.44 |
| CAS Registry Number | 24169-32-2 |
| EINECS | 246-054-0 |
| SMILES | C1=CC(=C(C(=C1C2(OCCO2)CBr)Cl)Cl)Cl |
| InChI | 1S/C10H8BrCl3O2/c11-5-10(15-3-4-16-10)6-1-2-7(12)9(14)8(6)13/h1-2H,3-5H2 |
| InChIKey | PFSSVZKNVAXVRA-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.871°C at 760 mmHg (Cal.) |
| Flash point | 198.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Bromomethyl)-2-(2,3,4-Trichlorophenyl)-1,3-Dioxolane |