|
CAS#: 24184-37-0 Product: Ethyl L-Asparaginate Hydrochloride (1:1) No suppilers available for the product. |
| Name | Ethyl L-Asparaginate Hydrochloride (1:1) |
|---|---|
| Synonyms | ethyl L-asparaginate monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13ClN2O3 |
| Molecular Weight | 196.63 |
| CAS Registry Number | 24184-37-0 |
| EINECS | 246-066-6 |
| SMILES | Cl.N[C@@H](CC(N)=O)C(=O)OCC |
| InChI | 1S/C6H12N2O3.ClH/c1-2-11-6(10)4(7)3-5(8)9;/h4H,2-3,7H2,1H3,(H2,8,9);1H/t4-;/m0./s1 |
| InChIKey | RIGBOVZPZYVXER-WCCKRBBISA-N |
| Boiling point | 362°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 172.8°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl L-Asparaginate Hydrochloride (1:1) |