|
CAS#: 24201-58-9 Product: Dichlozoline No suppilers available for the product. |
| Name | Dichlozoline |
|---|---|
| Synonyms | 3-(3,5-Dichlorophenyl)-5,5-Dimethyl-Oxazolidine-2,4-Dione; 3-(3,5-Dichlorophenyl)-5,5-Dimethyloxazolidine-2,4-Dione; 3-(3,5-Dichlorophenyl)-5,5-Dimethyl-Oxazolidine-2,4-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 |
| CAS Registry Number | 24201-58-9 |
| SMILES | C1=C(Cl)C=C(C=C1Cl)N2C(=O)OC(C2=O)(C)C |
| InChI | 1S/C11H9Cl2NO3/c1-11(2)9(15)14(10(16)17-11)8-4-6(12)3-7(13)5-8/h3-5H,1-2H3 |
| InChIKey | JDZSMXLTQNHBRF-UHFFFAOYSA-N |
| Density | 1.44g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.839°C at 760 mmHg (Cal.) |
| Flash point | 171.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichlozoline |