|
CAS#: 2422-79-9 Product: 12-Methylbenzo[a]Anthracene No suppilers available for the product. |
| Name | 12-Methylbenzo[a]Anthracene |
|---|---|
| Synonyms | 12-Methylbenz[A]Anthracene; Benz[A]Anthracene, 12-Methyl-; Nsc409460 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 |
| CAS Registry Number | 2422-79-9 |
| SMILES | C1=CC=CC3=C1C(=C2C4=C(C=CC2=C3)C=CC=C4)C |
| InChI | 1S/C19H14/c1-13-17-8-4-3-7-15(17)12-16-11-10-14-6-2-5-9-18(14)19(13)16/h2-12H,1H3 |
| InChIKey | ACYOLKMEHHTLAB-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.425°C at 760 mmHg (Cal.) |
| Flash point | 217.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Methylbenzo[a]Anthracene |