|
CAS#: 24265-34-7 Product: 2-Nitrophenyl chloroacetate No suppilers available for the product. |
| Name | 2-Nitrophenyl chloroacetate |
|---|---|
| Synonyms | 2-Chloroacetic Acid (2-Nitrophenyl) Ester; (2-Nitrophenyl) 2-Chloroethanoate; 2-Nitrophenyl Chloroacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59 |
| CAS Registry Number | 24265-34-7 |
| SMILES | C1=CC=CC(=C1[N+]([O-])=O)OC(CCl)=O |
| InChI | 1S/C8H6ClNO4/c9-5-8(11)14-7-4-2-1-3-6(7)10(12)13/h1-4H,5H2 |
| InChIKey | UCBRWZIQQPBXNJ-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.849°C at 760 mmHg (Cal.) |
| Flash point | 151.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitrophenyl chloroacetate |