Online Database of Chemicals from Around the World
|
CAS#: 2428-31-1 Product: (1E)-1-[(3,4,5-Trimethoxyphenyl)Methylidene]Indene No suppilers available for the product. |
| Name | (1E)-1-[(3,4,5-Trimethoxyphenyl)Methylidene]Indene |
|---|---|
| Synonyms | 1-[(3,4,5-Trimethoxyphenyl)Methylidene]Indene; (1E)-1-[(3,4,5-Trimethoxyphenyl)Methylene]Indene; 1-[(3,4,5-Trimethoxyphenyl)Methylene]Indene |
| Molecular Structure | ![CAS#: 2428-31-1, (1E)-1-[(3,4,5-Trimethoxyphenyl)Methylidene]Indene](/moreStructures/2428-31-1.gif) |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 |
| CAS Registry Number | 2428-31-1 |
| SMILES | C1=CC=CC3=C1\C(=C\C2=CC(=C(OC)C(=C2)OC)OC)C=C3 |
| InChI | 1S/C19H18O3/c1-20-17-11-13(12-18(21-2)19(17)22-3)10-15-9-8-14-6-4-5-7-16(14)15/h4-12H,1-3H3/b15-10+ |
| InChIKey | VUWQTQJXINKVKM-XNTDXEJSSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.492°C at 760 mmHg (Cal.) |
| Flash point | 151.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1E)-1-[(3,4,5-Trimethoxyphenyl)Methylidene]Indene |