|
CAS#: 24313-71-1 Product: Methyl 4-(Phenyliminomethyl)Benzoate No suppilers available for the product. |
| Name | Methyl 4-(Phenyliminomethyl)Benzoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 |
| CAS Registry Number | 24313-71-1 |
| SMILES | COC(=O)c1ccc(cc1)C=Nc2ccccc2 |
| InChI | 1S/C15H13NO2/c1-18-15(17)13-9-7-12(8-10-13)11-16-14-5-3-2-4-6-14/h2-11H,1H3 |
| InChIKey | LUQFLQBIMGTTCL-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.156°C at 760 mmHg (Cal.) |
| Flash point | 166.485°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(Phenyliminomethyl)Benzoate |