|
CAS#: 24340-62-3 Product: 6-Methoxy-3-(6-Methoxy-1,3-Benzodioxol-5-Yl)-8,8-Dimethyl-4H,8H-Pyrano[2,3-f]Chromen-4-One No suppilers available for the product. |
| Name | 6-Methoxy-3-(6-Methoxy-1,3-Benzodioxol-5-Yl)-8,8-Dimethyl-4H,8H-Pyrano[2,3-f]Chromen-4-One |
|---|---|
| Synonyms | ICHTHYNONE; DivK1c_006731 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.40 |
| CAS Registry Number | 24340-62-3 |
| SMILES | O=C4c5cc(OC)c1OC(/C=C\c1c5O\C=C4\c3cc2OCOc2cc3OC)(C)C |
| InChI | 1S/C23H20O7/c1-23(2)6-5-12-21-14(8-19(26-4)22(12)30-23)20(24)15(10-27-21)13-7-17-18(29-11-28-17)9-16(13)25-3/h5-10H,11H2,1-4H3 |
| InChIKey | NPYOKEDYJXYSTA-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.281°C at 760 mmHg (Cal.) |
| Flash point | 262.195°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-3-(6-Methoxy-1,3-Benzodioxol-5-Yl)-8,8-Dimethyl-4H,8H-Pyrano[2,3-f]Chromen-4-One |