Online Database of Chemicals from Around the World
|
CAS#: 24351-55-1 Product: Ethyl 3-(1,3-Benzodioxol-5-Yl)Benzoate No suppilers available for the product. |
| Name | Ethyl 3-(1,3-Benzodioxol-5-Yl)Benzoate |
|---|---|
| Synonyms | 3-Benzo[1,3]dioxol-5-yl-benzoic acid ethyl ester |
| Molecular Structure |  |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Registry Number | 24351-55-1 |
| SMILES | CCOC(=O)c1cccc(c1)c2ccc3c(c2)OCO3 |
| InChI | 1S/C16H14O4/c1-2-18-16(17)13-5-3-4-11(8-13)12-6-7-14-15(9-12)20-10-19-14/h3-9H,2,10H2,1H3 |
| InChIKey | WMPPBCWIPOEIHX-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.104°C at 760 mmHg (Cal.) |
| Flash point | 186.923°C (Cal.) |
| Refractive index | 1.581 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(1,3-Benzodioxol-5-Yl)Benzoate |