|
CAS#: 24353-58-0 Product: Delachlor No suppilers available for the product. |
| Name | Delachlor |
|---|---|
| Synonyms | 2-Chloro-N-(2,6-Dimethylphenyl)-N-(Isobutoxymethyl)Acetamide; 2-Chloro-N-(2,6-Dimethylphenyl)-N-(2-Methylpropoxymethyl)Ethanamide; Cp 52223 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 |
| CAS Registry Number | 24353-58-0 (39340-28-8) |
| SMILES | C1=C(C(=C(C=C1)C)N(C(CCl)=O)COCC(C)C)C |
| InChI | 1S/C15H22ClNO2/c1-11(2)9-19-10-17(14(18)8-16)15-12(3)6-5-7-13(15)4/h5-7,11H,8-10H2,1-4H3 |
| InChIKey | BIQOEDQVNIYWPQ-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.376°C at 760 mmHg (Cal.) |
| Flash point | 188.683°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Delachlor |