|
CAS#: 2437-54-9 Product: 1,4,6-Trichloronaphthalene No suppilers available for the product. |
| Name | 1,4,6-Trichloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,4,6-Trichloro; Naphthalene, 1,4,6-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl3 |
| Molecular Weight | 231.51 |
| CAS Registry Number | 2437-54-9 |
| SMILES | C2=CC1=C(C=CC(=C1C=C2Cl)Cl)Cl |
| InChI | 1S/C10H5Cl3/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-5H |
| InChIKey | RLTTZFDRZKJVKJ-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.494°C at 760 mmHg (Cal.) |
| Flash point | 216.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,6-Trichloronaphthalene |