|
CAS#: 243977-26-6 Product: 5-(2-Chlorophenyl)-2-(Trifluoromethyl)-3-Furoic Acid No suppilers available for the product. |
| Name | 5-(2-Chlorophenyl)-2-(Trifluoromethyl)-3-Furoic Acid |
|---|---|
| Synonyms | 3-FURANCA |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6ClF3O3 |
| Molecular Weight | 290.62 |
| CAS Registry Number | 243977-26-6 |
| SMILES | FC(F)(F)c2oc(c1c(Cl)cccc1)cc2C(=O)O |
| InChI | 1S/C12H6ClF3O3/c13-8-4-2-1-3-6(8)9-5-7(11(17)18)10(19-9)12(14,15)16/h1-5H,(H,17,18) |
| InChIKey | IOFLJWSDJUXMQP-UHFFFAOYSA-N |
| Density | 1.487g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.562°C at 760 mmHg (Cal.) |
| Flash point | 186.377°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-Chlorophenyl)-2-(Trifluoromethyl)-3-Furoic Acid |