|
CAS#: 24404-97-5 Product: N5-(Diaminomethylene)-L-Ornithine 2-Hydroxy-1,2,3-Propanetricarboxylate (1:1) No suppilers available for the product. |
| Name | N5-(Diaminomethylene)-L-Ornithine 2-Hydroxy-1,2,3-Propanetricarboxylate (1:1) |
|---|---|
| Synonyms | L-arginine monocitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22N4O9 |
| Molecular Weight | 366.32 |
| CAS Registry Number | 24404-97-5 |
| EINECS | 246-230-7 |
| SMILES | O=C(O)CC(O)(C(=O)O)CC(=O)O.O=C(O)[C@@H](N)CCC/N=C(\N)N |
| InChI | 1S/C6H14N4O2.C6H8O7/c7-4(5(11)12)2-1-3-10-6(8)9;7-3(8)1-6(13,5(11)12)2-4(9)10/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t4-;/m0./s1 |
| InChIKey | SGJSPXDVZJIWEO-WCCKRBBISA-N |
| Boiling point | 309.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.2°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N5-(Diaminomethylene)-L-Ornithine 2-Hydroxy-1,2,3-Propanetricarboxylate (1:1) |