|
CAS#: 24407-35-0 Product: alpha-(Dimethylhydrazono)-4'-Methylacetophenone No suppilers available for the product. |
| Name | alpha-(Dimethylhydrazono)-4'-Methylacetophenone |
|---|---|
| Synonyms | (2E)-2-(Dimethylhydrazono)-1-(4-Methylphenyl)Ethanone; Brn 2439780; Glyoxal, P-Tolyl-, Dimethyl Hydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.24 |
| CAS Registry Number | 24407-35-0 |
| SMILES | C1=C(C(=O)/C=N/N(C)C)C=CC(=C1)C |
| InChI | 1S/C11H14N2O/c1-9-4-6-10(7-5-9)11(14)8-12-13(2)3/h4-8H,1-3H3/b12-8+ |
| InChIKey | BYWZDRVDOARNLV-XYOKQWHBSA-N |
| Density | 0.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.669°C at 760 mmHg (Cal.) |
| Flash point | 135.64°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Dimethylhydrazono)-4'-Methylacetophenone |