|
CAS#: 24456-79-9 Product: 5,5'-Dihydroxy-7,7'-Dimethyl-2,2'-Binaphthalene-1,1',4,4'-Tetrone No suppilers available for the product. |
| Name | 5,5'-Dihydroxy-7,7'-Dimethyl-2,2'-Binaphthalene-1,1',4,4'-Tetrone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H14O6 |
| Molecular Weight | 374.34 |
| CAS Registry Number | 24456-79-9 |
| SMILES | O=C3\C=C(\C2=C\C(=O)c1c(O)cc(cc1C2=O)C)C(=O)c4cc(cc(O)c34)C |
| InChI | 1S/C22H14O6/c1-9-3-13-19(15(23)5-9)17(25)7-11(21(13)27)12-8-18(26)20-14(22(12)28)4-10(2)6-16(20)24/h3-8,23-24H,1-2H3 |
| InChIKey | WZWDIPBLRMIRHM-UHFFFAOYSA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 626.719°C at 760 mmHg (Cal.) |
| Flash point | 346.838°C (Cal.) |
| Refractive index | 1.728 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Dihydroxy-7,7'-Dimethyl-2,2'-Binaphthalene-1,1',4,4'-Tetrone |