|
CAS#: 24487-50-1 Product: 3-Tert-Butylphenyl=N,N-Dimethylcarbamate No suppilers available for the product. |
| Name | 3-Tert-Butylphenyl=N,N-Dimethylcarbamate |
|---|---|
| Synonyms | N,N-Dimethylcarbamic Acid (3-Tert-Butylphenyl) Ester; Brn 3053671; Phenol, M-Tert-Butyl-, Dimethylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 |
| CAS Registry Number | 24487-50-1 |
| SMILES | C1=C(C=CC=C1OC(N(C)C)=O)C(C)(C)C |
| InChI | 1S/C13H19NO2/c1-13(2,3)10-7-6-8-11(9-10)16-12(15)14(4)5/h6-9H,1-5H3 |
| InChIKey | CJXRFEACYKDEKK-UHFFFAOYSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.548°C at 760 mmHg (Cal.) |
| Flash point | 130.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Tert-Butylphenyl=N,N-Dimethylcarbamate |