Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 6-{(E)-[(Dimethylamino)Methylene]Amino}Nicotinate |
|---|---|
| Synonyms | (E)-methyl 6-(((dimethylamino)methylene)amino)nicotinate |
| Molecular Structure | ![CAS#: 245413-62-1, Methyl 6-{(E)-[(Dimethylamino)Methylene]Amino}Nicotinate](/moreStructures/245413-62-1.gif) |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 |
| CAS Registry Number | 245413-62-1 |
| SMILES | O=C(OC)c1cnc(/N=C/N(C)C)cc1 |
| InChI | 1S/C10H13N3O2/c1-13(2)7-12-9-5-4-8(6-11-9)10(14)15-3/h4-7H,1-3H3/b12-7+ |
| InChIKey | YYXIRFAXTBIZSP-KPKJPENVSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.397°C at 760 mmHg (Cal.) |
| Flash point | 148.78°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 6-{(E)-[(Dimethylamino)Methylene]Amino}Nicotinate |