Online Database of Chemicals from Around the World
|
CAS#: 2455-92-7 Product: 4-Chloro-3-Sulfamoyl-Benzamide No suppilers available for the product. |
| Name | 4-Chloro-3-Sulfamoyl-Benzamide |
|---|---|
| Synonyms | Sulclamidum; 4-Chlor-3-Sulfamoylbenzamid; 4-Chloro-3-Sulfamoylbenzamide |
| Molecular Structure |  |
| Molecular Formula | C7H7ClN2O3S |
| Molecular Weight | 234.66 |
| CAS Registry Number | 2455-92-7 |
| SMILES | C1=C(C=CC(=C1[S](N)(=O)=O)Cl)C(N)=O |
| InChI | 1S/C7H7ClN2O3S/c8-5-2-1-4(7(9)11)3-6(5)14(10,12)13/h1-3H,(H2,9,11)(H2,10,12,13) |
| InChIKey | WRLKLPDTRUYBBV-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.774°C at 760 mmHg (Cal.) |
| Flash point | 223.396°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3-Sulfamoyl-Benzamide |