Online Database of Chemicals from Around the World
|
CAS#: 24568-67-0 Product: Elsinochrome A No suppilers available for the product. |
| Name | Elsinochrome A |
|---|---|
| Synonyms | Elsinochrome A; Nsc623609 |
| Molecular Structure |  |
| Molecular Formula | C30H24O10 |
| Molecular Weight | 544.51 |
| CAS Registry Number | 24568-67-0 |
| SMILES | CC(=O)C1C(C4=C3C2=C1C(=C(O)C6=C2C(=C5C3=C(C(=C4OC)O)C(=O)C=C5OC)C(=CC6=O)OC)OC)C(=O)C |
| InChI | 1S/C30H24O10/c1-9(31)15-16(10(2)32)26-24-22-18(28(36)30(26)40-6)12(34)8-14(38-4)20(22)19-13(37-3)7-11(33)17-21(19)23(24)25(15)29(39-5)27(17)35/h7-8,15-16,35-36H,1-6H3 |
| InChIKey | SVDUCZIGPIYIHQ-UHFFFAOYSA-N |
| Density | 1.554g/cm3 (Cal.) |
|---|---|
| Boiling point | 854.005°C at 760 mmHg (Cal.) |
| Flash point | 286.671°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Elsinochrome A |