|
CAS#: 2458-05-1 Product: Methyl 3-methyl-2-(methylthio)-6-nitrobenzothiazolium sulphate No suppilers available for the product. |
| Name | Methyl 3-methyl-2-(methylthio)-6-nitrobenzothiazolium sulphate |
|---|---|
| Synonyms | 3-Methyl-2-(Methylthio)-6-Nitro-1,3-Benzothiazol-3-Ium; Methyl Sulfate; Nsc124198 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O6S3 |
| Molecular Weight | 352.39 |
| CAS Registry Number | 2458-05-1 |
| EINECS | 219-541-0 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1SC(=[N+]2C)SC.CO[S]([O-])(=O)=O |
| InChI | 1S/C9H9N2O2S2.CH4O4S/c1-10-7-4-3-6(11(12)13)5-8(7)15-9(10)14-2;1-5-6(2,3)4/h3-5H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | UHXYAEXVNYMRKZ-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-methyl-2-(methylthio)-6-nitrobenzothiazolium sulphate |