|
CAS#: 24656-41-5 Product: Lysergic Acid Diethylamide Maleate No suppilers available for the product. |
| Name | Lysergic Acid Diethylamide Maleate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 |
| CAS Registry Number | 24656-41-5 |
| SMILES | [C@H]14N(C[C@@H](C=C1C3=C2C(=C[NH]C2=CC=C3)C4)C(=O)N(CC)CC)C.O=C(O)\C=C/C(=O)O |
| InChI | 1S/C20H25N3O.C4H4O4/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14;5-3(6)1-2-4(7)8/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,18-;/m1./s1 |
| InChIKey | PBZHMSZIBQNTPH-ZYXUSYCASA-N |
| Boiling point | 541.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 281.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lysergic Acid Diethylamide Maleate |