|
CAS#: 24684-41-1 Product: 11-Methyl-15,16-Dihydro-17H-Cyclopenta[a]Phenanthrene No suppilers available for the product. |
| Name | 11-Methyl-15,16-Dihydro-17H-Cyclopenta[a]Phenanthrene |
|---|---|
| Synonyms | Brn 3268798; 11-Methyl-15,16-Dihydro-17H-Cyclopenta(A)Phenanthrene; 15H-Cyclopenta(A)Phenanthrene, 16,17-Dihydro-11-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 24684-41-1 |
| SMILES | C1=C2C(=CC=C1)C=CC3=C2C(=CC4=C3CCC4)C |
| InChI | 1S/C18H16/c1-12-11-14-6-4-8-15(14)17-10-9-13-5-2-3-7-16(13)18(12)17/h2-3,5,7,9-11H,4,6,8H2,1H3 |
| InChIKey | XZIIXGOAGARMHM-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.119°C at 760 mmHg (Cal.) |
| Flash point | 197.52°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Methyl-15,16-Dihydro-17H-Cyclopenta[a]Phenanthrene |