|
CAS#: 2471-08-1 Product: Hexacosamethyldodecasiloxane No suppilers available for the product. |
| Name | Hexacosamethyldodecasiloxane |
|---|---|
| Synonyms | 8/1/2471; Dodecasiloxane, hexacosamethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H78O11Si12 |
| Molecular Weight | 903.92 |
| CAS Registry Number | 2471-08-1 |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | 1S/C26H78O11Si12/c1-38(2,3)27-40(7,8)29-42(11,12)31-44(15,16)33-46(19,20)35-48(23,24)37-49(25,26)36-47(21,22)34-45(17,18)32-43(13,14)30-41(9,10)28-39(4,5)6/h1-26H3 |
| InChIKey | CJRWALLMSORFIV-UHFFFAOYSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.504°C at 760 mmHg (Cal.) |
| Flash point | 274.318°C (Cal.) |
| Refractive index | 1.428 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hexacosamethyldodecasiloxane |