|
CAS#: 247566-38-7 Product: Ethyl (2S)-2-Amino-3-(4-Bromophenyl)Propanoate No suppilers available for the product. |
| Name | Ethyl (2S)-2-Amino-3-(4-Bromophenyl)Propanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 |
| CAS Registry Number | 247566-38-7 |
| SMILES | CCOC(=O)[C@H](Cc1ccc(cc1)Br)N |
| InChI | 1S/C11H14BrNO2/c1-2-15-11(14)10(13)7-8-3-5-9(12)6-4-8/h3-6,10H,2,7,13H2,1H3/t10-/m0/s1 |
| InChIKey | YIRKWTZNRFSZGH-JTQLQIEISA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.121°C at 760 mmHg (Cal.) |
| Flash point | 157.685°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2S)-2-Amino-3-(4-Bromophenyl)Propanoate |