|
CAS#: 24759-04-4 Product: (Z)-2-Chloro-4-oxo-2-Hexenedioic acid No suppilers available for the product. |
| Name | (Z)-2-Chloro-4-oxo-2-Hexenedioic acid |
|---|---|
| Synonyms | (E)-2-Chloro-4-Oxo-Hex-2-Enedioic Acid; (E)-2-Chloro-4-Keto-Hex-2-Enedioic Acid; 2-Chloromaleylacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5ClO5 |
| Molecular Weight | 192.56 |
| CAS Registry Number | 24759-04-4 |
| SMILES | C(C(=O)\C=C(Cl)/C(O)=O)C(O)=O |
| InChI | 1S/C6H5ClO5/c7-4(6(11)12)1-3(8)2-5(9)10/h1H,2H2,(H,9,10)(H,11,12)/b4-1+ |
| InChIKey | QOHGUQUQCPIROQ-DAFODLJHSA-N |
| Density | 1.622g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.852°C at 760 mmHg (Cal.) |
| Flash point | 210.138°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-2-Chloro-4-oxo-2-Hexenedioic acid |