Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N-[(Benzyloxy)Carbonyl]Methionylalanine |
|---|---|
| Synonyms | Z-MET-ALA-OH |
| Molecular Structure | ![CAS#: 24787-85-7, N-[(Benzyloxy)Carbonyl]Methionylalanine](/moreStructures/24787-85-7.gif) |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.42 |
| CAS Registry Number | 24787-85-7 |
| SMILES | O=C(O)C(NC(=O)C(NC(=O)OCc1ccccc1)CCSC)C |
| InChI | 1S/C16H22N2O5S/c1-11(15(20)21)17-14(19)13(8-9-24-2)18-16(22)23-10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | WNPCADDTHHEWIB-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 642.369°C at 760 mmHg (Cal.) |
| Flash point | 342.293°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Benzyloxy)Carbonyl]Methionylalanine |