|
CAS#: 24815-96-1 Product: (16beta,17beta)-16,17-Dihydroxyestr-4-En-3-One No suppilers available for the product. |
| Name | (16beta,17beta)-16,17-Dihydroxyestr-4-En-3-One |
|---|---|
| Synonyms | 16β-Hydroxynandrolone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 |
| CAS Registry Number | 24815-96-1 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@@H]([C@@H]2O)O)CCC4=CC(=O)CC[C@H]34 |
| InChI | 1S/C18H26O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h8,12-17,20-21H,2-7,9H2,1H3/t12-,13+,14+,15-,16-,17-,18-/m0/s1 |
| InChIKey | LUSFIVNVJFSWMR-FZANTTLGSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 244.4±25.2°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (16beta,17beta)-16,17-Dihydroxyestr-4-En-3-One |