|
CAS#: 24851-91-0 Product: 1,5-Cyclohexadien-1-Ylmethyl Benzoate No suppilers available for the product. |
| Name | 1,5-Cyclohexadien-1-Ylmethyl Benzoate |
|---|---|
| Synonyms | 1,5-Cyclohexadien-1-ylmethyl benzoate; 1,5-Cyclohexadien-1-ylmethyl-benzoat; 1,5-Cyclohexadiene-1-methanol, benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 24851-91-0 |
| SMILES | c1ccc(cc1)C(=O)OCC2=CCCC=C2 |
| InChI | 1S/C14H14O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h2-3,5-10H,1,4,11H2 |
| InChIKey | FULLNKFMBXXSDH-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.4±21.0°C at 760 mmHg (Cal.) |
| Flash point | 156.0±8.2°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Cyclohexadien-1-Ylmethyl Benzoate |