Online Database of Chemicals from Around the World
|
CAS#: 2486-04-6 Product: 2,4-Dinitro-1-Phenylbenzene No suppilers available for the product. |
| Name | 2,4-Dinitro-1-Phenylbenzene |
|---|---|
| Synonyms | 2,4-Dinitro-1-Phenyl-Benzene; 2,4-Dinitrobiphenyl; Ccris 4053 |
| Molecular Structure |  |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 |
| CAS Registry Number | 2486-04-6 |
| SMILES | C1=CC(=CC(=C1C2=CC=CC=C2)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C12H8N2O4/c15-13(16)10-6-7-11(12(8-10)14(17)18)9-4-2-1-3-5-9/h1-8H |
| InChIKey | DBTRHJMMJLOORC-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.048°C at 760 mmHg (Cal.) |
| Flash point | 184.052°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitro-1-Phenylbenzene |