Online Database of Chemicals from Around the World
|
CAS#: 24875-94-3 Product: 1-(6-Methyl-2-Naphthyl)Ethanone No suppilers available for the product. |
| Name | 1-(6-Methyl-2-Naphthyl)Ethanone |
|---|---|
| Synonyms | 1-(6-Methyl-2-naphthalenyl)ethanone; 1-(6-Methyl-2-naphthyl)ethanone #; 2-Acetyl-6-methylnaphthalene |
| Molecular Structure |  |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.23 |
| CAS Registry Number | 24875-94-3 |
| SMILES | O=C(c1ccc2c(c1)ccc(c2)C)C |
| InChI | 1S/C13H12O/c1-9-3-4-13-8-11(10(2)14)5-6-12(13)7-9/h3-8H,1-2H3 |
| InChIKey | SPAYGOAEIJHIDE-UHFFFAOYSA-N |
| Density | 1.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.956°C at 760 mmHg (Cal.) |
| Flash point | 138.032°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(6-Methyl-2-Naphthyl)Ethanone |