|
CAS#: 24897-98-1 Product: 3',4,4',5,7-Flavanpentol No suppilers available for the product. |
| Name | 3',4,4',5,7-Flavanpentol |
|---|---|
| Synonyms | 3-Deoxyleucocyanidin; C05907; Luteoforol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 |
| CAS Registry Number | 24897-98-1 |
| SMILES | [C@H]1(CC(C2=C(O1)C=C(C=C2O)O)O)C3=CC(=C(C=C3)O)O |
| InChI | 1S/C15H14O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,12-13,16-20H,6H2/t12?,13-/m0/s1 |
| InChIKey | FSYDWKPCKNCRDI-ABLWVSNPSA-N |
| Density | 1.593g/cm3 (Cal.) |
|---|---|
| Boiling point | 615.788°C at 760 mmHg (Cal.) |
| Flash point | 326.217°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',4,4',5,7-Flavanpentol |