|
CAS#: 2492-03-7 Product: 5-Methyl-2-[(E)-2-(4-Phenylphenyl)Vinyl]-1,3-Benzoxazole No suppilers available for the product. |
| Name | 5-Methyl-2-[(E)-2-(4-Phenylphenyl)Vinyl]-1,3-Benzoxazole |
|---|---|
| Synonyms | (E)-2-(4-phenylstyryl)-5-methylbenzoxazole |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17NO |
| Molecular Weight | 311.38 |
| CAS Registry Number | 2492-03-7 |
| SMILES | Cc1ccc2c(c1)nc(o2)/C=C/c3ccc(cc3)c4ccccc4 |
| InChI | 1S/C22H17NO/c1-16-7-13-21-20(15-16)23-22(24-21)14-10-17-8-11-19(12-9-17)18-5-3-2-4-6-18/h2-15H,1H3/b14-10+ |
| InChIKey | LMGKWSSOGCGRMB-GXDHUFHOSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.7°C at 760 mmHg (Cal.) |
| Flash point | 220.416°C (Cal.) |
| Refractive index | 1.692 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-[(E)-2-(4-Phenylphenyl)Vinyl]-1,3-Benzoxazole |