|
CAS#: 24938-68-9 Product: Poly[p-(2,6-diphenyl)phenylene oxide] No suppilers available for the product. |
| Name | Poly[p-(2,6-diphenyl)phenylene oxide] |
|---|---|
| Synonyms | Nsc 170915; Poly(Oxy(1,1':3',1''-Terphenyl)-2',5'-Diyl); Tenax Gc |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 |
| CAS Registry Number | 24938-68-9 |
| SMILES | C1=C(C=C(C(=C1C2=CC=CC=C2)OC)C3=CC=CC=C3)C |
| InChI | 1S/C20H18O/c1-15-13-18(16-9-5-3-6-10-16)20(21-2)19(14-15)17-11-7-4-8-12-17/h3-14H,1-2H3 |
| InChIKey | TWADJGWUKGOPFG-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.946°C at 760 mmHg (Cal.) |
| Flash point | 142.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly[p-(2,6-diphenyl)phenylene oxide] |