|
CAS#: 2501-37-3 Product: N-[(E)-2-(4-Methoxyphenyl)Ethenyl]Formamide No suppilers available for the product. |
| Name | N-[(E)-2-(4-Methoxyphenyl)Ethenyl]Formamide |
|---|---|
| Synonyms | N-[2-(4-Methoxyphenyl)Ethenyl]Formamide; N-[2-(4-Methoxyphenyl)Vinyl]Formamide; N-[(E)-2-(4-Methoxyphenyl)Vinyl]Formamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 |
| CAS Registry Number | 2501-37-3 (53643-53-1) |
| SMILES | C1=C(C=CC(=C1)OC)\C=C\NC=O |
| InChI | 1S/C10H11NO2/c1-13-10-4-2-9(3-5-10)6-7-11-8-12/h2-8H,1H3,(H,11,12)/b7-6+ |
| InChIKey | SZCZSKMCTGEJKI-VOTSOKGWSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.7±34.0°C at 760 mmHg (Cal.) |
| Flash point | 190.7±25.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(E)-2-(4-Methoxyphenyl)Ethenyl]Formamide |