| Name | Poly(p-Phenylene Terephthalamide) |
|---|---|
| Synonyms | P-Phenylenediamine; Terephthalic Acid; 1,4-Benzenedicarboxylic Acid, Polymer With 1,4-Benzenediamine; Kevlar 29, Monomer-Based |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 |
| CAS Registry Number | 25035-37-4 |
| SMILES | C1=C(C=CC(=C1)C(=O)O)C(=O)O.C2=C(N)C=CC(=C2)N |
| InChI | 1S/C8H6O4.C6H8N2/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-5-1-2-6(8)4-3-5/h1-4H,(H,9,10)(H,11,12);1-4H,7-8H2 |
| InChIKey | STTCDNLESVYWPH-UHFFFAOYSA-N |
| Boiling point | 392.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(p-Phenylene Terephthalamide) |