| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,3-Dichloro-1,3-Butadiene Polymer With 2-Chloro-1,3-Butadiene |
|---|---|
| Synonyms | Poly(1,3-Butadiene, 2-Chloro:1,3-Butadiene, 2,3-Dichloro-); 1,3-Butadiene, 2,3-Dichloro-, Polymer With 2-Chloro-1,3-Butadiene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9Cl3 |
| Molecular Weight | 211.52 |
| CAS Registry Number | 25067-95-2 |
| SMILES | C(Cl)(C(Cl)=C)=C.C(Cl)(C=C)=C |
| InChI | 1S/C4H4Cl2.C4H5Cl/c1-3(5)4(2)6;1-3-4(2)5/h1-2H2;3H,1-2H2 |
| InChIKey | NAQXXKYGYBHHJB-UHFFFAOYSA-N |
| Boiling point | 98°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 37.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dichloro-1,3-Butadiene Polymer With 2-Chloro-1,3-Butadiene |