|
CAS#: 25097-42-1 Product: Tert-Butyl(4-Tert-Butylphenyl)Phosphinic Acid No suppilers available for the product. |
| Name | Tert-Butyl(4-Tert-Butylphenyl)Phosphinic Acid |
|---|---|
| Synonyms | Phosphinic Acid, Tert-Butyl(P-Tert-Butylphenyl)- (8Ci); Nsc 134097; Nsc134097 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23O2P |
| Molecular Weight | 254.31 |
| CAS Registry Number | 25097-42-1 |
| SMILES | C1=CC(=CC=C1[P](=O)(O)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C14H23O2P/c1-13(2,3)11-7-9-12(10-8-11)17(15,16)14(4,5)6/h7-10H,1-6H3,(H,15,16) |
| InChIKey | TVQBXSAUENTUMA-UHFFFAOYSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.364°C at 760 mmHg (Cal.) |
| Flash point | 198.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl(4-Tert-Butylphenyl)Phosphinic Acid |