|
CAS#: 251102-25-7 Product: 1-ethyl-3-methyl-imidazol-1-ium methyl carbonate No suppilers available for the product. |
| Name | 1-ethyl-3-methyl-imidazol-1-ium methyl carbonate |
|---|---|
| Synonyms | 1-Ethyl-3-methyl-imidazolium methyl carbonate solution |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 251102-25-7 |
| SMILES | O=C([O-])OC.CC[n+]1ccn(C)c1 |
| InChI | 1S/C6H11N2.C2H4O3/c1-3-8-5-4-7(2)6-8;1-5-2(3)4/h4-6H,3H2,1-2H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | RJTZIWVIEAEYBG-UHFFFAOYSA-M |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-ethyl-3-methyl-imidazol-1-ium methyl carbonate |