|
CAS#: 25148-26-9 Product: 9-Methyl-10-(Chloromethyl)Anthracene No suppilers available for the product. |
| Name | 9-Methyl-10-(Chloromethyl)Anthracene |
|---|---|
| Synonyms | 9-(Chloromethyl)-10-Methyl-Anthracene; 10-(Chloromethyl)-9-Methylanthracene; 10-Chloromethyl-9-Methylanthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13Cl |
| Molecular Weight | 240.73 |
| CAS Registry Number | 25148-26-9 |
| SMILES | C1=CC=CC2=C(C)C3=C(C(=C12)CCl)C=CC=C3 |
| InChI | 1S/C16H13Cl/c1-11-12-6-2-4-8-14(12)16(10-17)15-9-5-3-7-13(11)15/h2-9H,10H2,1H3 |
| InChIKey | UHHQJUJHFOQCQJ-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.015°C at 760 mmHg (Cal.) |
| Flash point | 192.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methyl-10-(Chloromethyl)Anthracene |