|
CAS#: 25151-46-6 Product: Sodium 4-(Methoxycarbonyl)Benzoate No suppilers available for the product. |
| Name | Sodium 4-(Methoxycarbonyl)Benzoate |
|---|---|
| Synonyms | 1,4-Benzenedicarboxylic acid monomethyl ester sodium salt; Sodium methyl terephthalate; Sodium monomethyl terephthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NaO4 |
| Molecular Weight | 202.14 |
| CAS Registry Number | 25151-46-6 |
| SMILES | [Na+].O=C(OC)c1ccc(cc1)C([O-])=O |
| InChI | 1S/C9H8O4.Na/c1-13-9(12)7-4-2-6(3-5-7)8(10)11;/h2-5H,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | BRRIHMQIVUICIL-UHFFFAOYSA-M |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Sodium 4-(Methoxycarbonyl)Benzoate |