Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Tetrachlorophenol |
|---|---|
| Synonyms | Tetrachlorophenol, Isomer Unspecified; 2,3,4,5-Tetrachlorophenate; 4-06-00-01020 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C6H2Cl4O |
| Molecular Weight | 231.89 |
| CAS Registry Number | 25167-83-3 |
| SMILES | C1=C(C(=C(Cl)C(=C1O)Cl)Cl)Cl |
| InChI | 1S/C6H2Cl4O/c7-2-1-3(11)5(9)6(10)4(2)8/h1,11H |
| InChIKey | RULKYXXCCZZKDZ-UHFFFAOYSA-N |
| Density | 1.709g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.386°C at 760 mmHg (Cal.) |
| Flash point | 128.817°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrachlorophenol |