| Name | Phenyl 4-Bromophenyl Sulfoxide |
|---|---|
| Synonyms | 1-Bromo-4-Phenylsulfinyl-Benzene; 4-Bromodiphenyl Sulfoxide; Brn 4247696 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9BrOS |
| Molecular Weight | 281.17 |
| CAS Registry Number | 25186-92-9 |
| SMILES | C1=CC(=CC=C1Br)[S](=O)C2=CC=CC=C2 |
| InChI | 1S/C12H9BrOS/c13-10-6-8-12(9-7-10)15(14)11-4-2-1-3-5-11/h1-9H |
| InChIKey | ZTRXUNUYTUUDRR-UHFFFAOYSA-N |
| Density | 1.616g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.777°C at 760 mmHg (Cal.) |
| Flash point | 194.973°C (Cal.) |
| (1) | Francesco Naso, Cosimo Cardellicchio, Maria Annunziata M. Capozzi, Francesco Capitelli and Valerio Bertolasi. Self-assemblies of chiral p-haloaryl sulfoxides through C–H⋯O short contacts and halogen involving interactions, New J. Chem., 2006, 30, 1782. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenyl 4-Bromophenyl Sulfoxide |