|
CAS#: 25201-35-8 Product: Pentachloroacetophenone No suppilers available for the product. |
| Name | Pentachloroacetophenone |
|---|---|
| Synonyms | Acetophenone, 2',3',4',5',6'-Pentachloro-; Brn 1970874; Ethanone, 1-(Pentachlorophenyl)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H3Cl5O |
| Molecular Weight | 292.38 |
| CAS Registry Number | 25201-35-8 |
| SMILES | CC(C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)=O |
| InChI | 1S/C8H3Cl5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
| InChIKey | HPWXYMIPHGLDLX-UHFFFAOYSA-N |
| Density | 1.618g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.773°C at 760 mmHg (Cal.) |
| Flash point | 144.659°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachloroacetophenone |