|
CAS#: 25267-15-6 Product: Strobane No suppilers available for the product. |
| Name | Strobane |
|---|---|
| Synonyms | 2-Pinene, Octachloro- (8Ci); Octachloro-Alpha-Pinene; Strobane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl8 |
| Molecular Weight | 411.80 |
| CAS Registry Number | 25267-15-6 |
| SMILES | CC1(C2(Cl)C(Cl)(Cl)C(=C(C1C2Cl)C(Cl)(Cl)Cl)Cl)C |
| InChI | 1S/C10H8Cl8/c1-7(2)3-4(10(16,17)18)6(12)9(14,15)8(7,13)5(3)11/h3,5H,1-2H3 |
| InChIKey | IQOZFEVRAFTNGS-UHFFFAOYSA-N |
| Density | 1.685g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.582°C at 760 mmHg (Cal.) |
| Flash point | 157.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Strobane |