|
CAS#: 2529-64-8 Product: 3-Deoxy-17b-estradiol No suppilers available for the product. |
| Name | 3-Deoxy-17b-estradiol |
|---|---|
| Synonyms | (17Beta)-Estra-1,3,5(10)-Trien-17-Ol; 1,3,5(10)-Estratriene-17.Beta.-Ol; 17.Beta.-Estradiol, 3-Deoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 |
| CAS Registry Number | 2529-64-8 |
| SMILES | [C@]24([C@H]([C@@H]1CCC3=C([C@H]1CC2)C=CC=C3)CC[C@@H]4O)C |
| InChI | 1S/C18H24O/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19/h2-5,14-17,19H,6-11H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | MUENRDYXOADTOC-ZBRFXRBCSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.75°C at 760 mmHg (Cal.) |
| Flash point | 155.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Deoxy-17b-estradiol |